Introduction：Basic information about CAS 5713-57-5|Thiophene,2-[(4-methylphenyl)sulfonyl]-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Thiophene,2-[(4-methylphenyl)sulfonyl]- |
|---|
| CAS Number | 5713-57-5 | Molecular Weight | 238.32600 |
|---|
| Density | 1.298g/cm3 | Boiling Point | 398.4ºC at 760mmHg |
|---|
| Molecular Formula | C11H10O2S2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 194.7ºC |
|---|
Names
| Name | 2-(4-methylphenyl)sulfonylthiophene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.298g/cm3 |
|---|
| Boiling Point | 398.4ºC at 760mmHg |
|---|
| Molecular Formula | C11H10O2S2 |
|---|
| Molecular Weight | 238.32600 |
|---|
| Flash Point | 194.7ºC |
|---|
| Exact Mass | 238.01200 |
|---|
| PSA | 70.76000 |
|---|
| LogP | 3.97010 |
|---|
| Index of Refraction | 1.602 |
|---|
| InChIKey | WRVXLDHHLTUSJG-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(S(=O)(=O)c2cccs2)cc1 |
|---|
Synonyms
| 2-tosylthiophene |
| 2-<(4-methylphenyl)sulfonyl>-thiophene |
| (2-Thienyl)-(p-tolyl)-sulfon |
| 2-thienyl p-tolyl sulfone |
| 2-(toluene-4-sulfonyl)-thiophene |
