Introduction:Basic information about CAS 67643-67-8|2-(2-ethenoxyethyl)isoindole-1,3-dione, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(2-ethenoxyethyl)isoindole-1,3-dione |
|---|
| CAS Number | 67643-67-8 | Molecular Weight | 217.22100 |
|---|
| Density | 1.243g/cm3 | Boiling Point | 336.5ºC at 760 mmHg |
|---|
| Molecular Formula | C12H11NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 157.3ºC |
|---|
Names
| Name | 2-(2-ethenoxyethyl)isoindole-1,3-dione |
|---|
Chemical & Physical Properties
| Density | 1.243g/cm3 |
|---|
| Boiling Point | 336.5ºC at 760 mmHg |
|---|
| Molecular Formula | C12H11NO3 |
|---|
| Molecular Weight | 217.22100 |
|---|
| Flash Point | 157.3ºC |
|---|
| Exact Mass | 217.07400 |
|---|
| PSA | 46.61000 |
|---|
| LogP | 1.38060 |
|---|
| Index of Refraction | 1.575 |
|---|
| InChIKey | BSDNTVPHPRJNJD-UHFFFAOYSA-N |
|---|
| SMILES | C=COCCN1C(=O)c2ccccc2C1=O |
|---|