Introduction:Basic information about CAS 124678-35-9|1-(2-METHOXYETHYL)-2-THIOUREA, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-(2-METHOXYETHYL)-2-THIOUREA |
|---|
| CAS Number | 124678-35-9 | Molecular Weight | 229.27400 |
|---|
| Density | 1.07g/cm3 | Boiling Point | 386.6ºC at 760mmHg |
|---|
| Molecular Formula | C14H15NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 187.6ºC |
|---|
Names
| Name | 1-(2-methoxyphenyl)-2,5-dimethylpyrrole-3-carbaldehyde |
|---|
Chemical & Physical Properties
| Density | 1.07g/cm3 |
|---|
| Boiling Point | 386.6ºC at 760mmHg |
|---|
| Molecular Formula | C14H15NO2 |
|---|
| Molecular Weight | 229.27400 |
|---|
| Flash Point | 187.6ºC |
|---|
| Exact Mass | 229.11000 |
|---|
| PSA | 31.23000 |
|---|
| LogP | 2.91520 |
|---|
| Vapour Pressure | 1.04E-07mmHg at 25°C |
|---|
| Index of Refraction | 1.644 |
|---|
| InChIKey | LJUKIOLDWAYBCI-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccccc1-n1c(C)cc(C=O)c1C |
|---|