Introduction：Basic information about CAS 120568-11-8|5-[2-(4'-Methylbiphenyl)]tetrazole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-[2-(4'-Methylbiphenyl)]tetrazole |
|---|
| CAS Number | 120568-11-8 | Molecular Weight | 236.272 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 458.4±48.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H12N4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 214.5±22.5 °C |
|---|
Names
| Name | 5-(4'-Methyl-2-biphenylyl)-1H-tetrazole |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 458.4±48.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H12N4 |
|---|
| Molecular Weight | 236.272 |
|---|
| Flash Point | 214.5±22.5 °C |
|---|
| Exact Mass | 236.106201 |
|---|
| PSA | 54.46000 |
|---|
| LogP | 3.56 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.628 |
|---|
| InChIKey | VWOJMXKARYCRCC-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
|---|
Synonyms
| 5-[2-(4-methylphenyl)phenyl]-2H-tetrazole |
| Methylbiphenyl Tetrazole |
| 5-(4'-Methyl-2-biphenylyl)-1H-tetrazole |
| 5-(4'-methyl-[1,1'-biphenyl]-2-yl)-1H-tetrazole |
| 1H-Tetrazole, 5-(4'-methyl[1,1'-biphenyl]-2-yl)- |
| 5-[2-(4'-Methylbiphenyl)]tetrazole |
| Valsartan Impurity 9 |
