Introduction：Basic information about CAS 123417-18-5|Boc-Glu(ofm)-OH, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Boc-Glu(ofm)-OH |
|---|
| CAS Number | 123417-18-5 | Molecular Weight | 425.47400 |
|---|
| Density | 1.232 g/cm3 | Boiling Point | 633.5ºC at 760 mmHg |
|---|
| Molecular Formula | C24H27NO6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 336.9ºC |
|---|
Names
| Name | (2S)-5-(9H-fluoren-9-ylmethoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.232 g/cm3 |
|---|
| Boiling Point | 633.5ºC at 760 mmHg |
|---|
| Molecular Formula | C24H27NO6 |
|---|
| Molecular Weight | 425.47400 |
|---|
| Flash Point | 336.9ºC |
|---|
| Exact Mass | 425.18400 |
|---|
| PSA | 101.93000 |
|---|
| LogP | 4.49110 |
|---|
| Vapour Pressure | 6.39E-17mmHg at 25°C |
|---|
| Index of Refraction | 1.57 |
|---|
| InChIKey | RCQRXYWDDVULAP-FQEVSTJZSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)NC(CCC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
|---|
| Storage condition | 2-8°C |
|---|
Synonyms
| boc-l-glutamic acid 5-fluorenylmethyl ester |
| boc-glu-ofm |
| (S)-5-((9H-Fluoren-9-yl)methoxy)-2-((tert-butoxycarbonyl)amino)-5-oxopentanoic acid |
| MFCD00076934 |
| Boc-Glu(ofm)-OH |
