Introduction：Basic information about CAS 125971-57-5|2-Benzylidene isobutyryl acetanilide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Benzylidene isobutyryl acetanilide |
|---|
| CAS Number | 125971-57-5 | Molecular Weight | 293.360 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 519.4±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C19H19NO2 | Melting Point | 143-154ºC |
|---|
| MSDS | / | Flash Point | 188.7±30.3 °C |
|---|
Names
| Name | (2Z)-2-benzylidene-4-methyl-3-oxo-N-phenylpentanamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 519.4±50.0 °C at 760 mmHg |
|---|
| Melting Point | 143-154ºC |
|---|
| Molecular Formula | C19H19NO2 |
|---|
| Molecular Weight | 293.360 |
|---|
| Flash Point | 188.7±30.3 °C |
|---|
| Exact Mass | 293.141571 |
|---|
| PSA | 46.17000 |
|---|
| LogP | 4.11 |
|---|
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
|---|
| Index of Refraction | 1.622 |
|---|
| InChIKey | SMUFHBOCNIUNPT-LGMDPLHJSA-N |
|---|
| SMILES | CC(C)C(=O)C(=Cc1ccccc1)C(=O)Nc1ccccc1 |
|---|
Synonyms
| 2-Benzylidene-4-methyl-3-oxo-N-phenylpentanamide |
| 2-isobutyryl-N,3-diphenylacrylamide |
| (2Z)-2-Benzylidene-4-methyl-3-oxo-N-phenylpentanamide |
| Pentanamide, 4-methyl-3-oxo-N-phenyl-2-(phenylmethylene)-, (2Z)- |
| 2-Benzylidene isobutyryl acetanilide |
| MFCD00671709 |
