Introduction：Basic information about CAS 128454-94-4|1-Bromo-4,4,5,5,6,6,6-heptafluoro-3,3-bis(trifluoromethyl)hex-1-ene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-Bromo-4,4,5,5,6,6,6-heptafluoro-3,3-bis(trifluoromethyl)hex-1-ene |
|---|
| CAS Number | 128454-94-4 | Molecular Weight | 424.98500 |
|---|
| Density | 1.781g/cm3 | Boiling Point | 120.2ºC at 760 mmHg |
|---|
| Molecular Formula | C8H2BrF13 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 26.5ºC |
|---|
Names
| Name | 1-Bromo-4,4,5,5,6,6,6-heptafluoro-3,3-bis(trifluoromethyl)hex-1-ene |
|---|
Chemical & Physical Properties
| Density | 1.781g/cm3 |
|---|
| Boiling Point | 120.2ºC at 760 mmHg |
|---|
| Molecular Formula | C8H2BrF13 |
|---|
| Molecular Weight | 424.98500 |
|---|
| Flash Point | 26.5ºC |
|---|
| Exact Mass | 423.91300 |
|---|
| LogP | 5.83890 |
|---|
| Vapour Pressure | 18.5mmHg at 25°C |
|---|
| Index of Refraction | 1.331 |
|---|
| InChIKey | KVLSPRHWDKLGCE-UHFFFAOYSA-N |
|---|
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(C=CBr)(C(F)(F)F)C(F)(F)F |
|---|
