Introduction：Basic information about CAS 129446-71-5|(4S)-4-(2-HYDROXYETHYL)-2-PHENYL-1,3-DIOXOLANE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (4S)-4-(2-HYDROXYETHYL)-2-PHENYL-1,3-DIOXOLANE |
|---|
| CAS Number | 129446-71-5 | Molecular Weight | 237.25200 |
|---|
| Density | 1.303g/cm3 | Boiling Point | 446.8ºC at 760mmHg |
|---|
| Molecular Formula | C12H15NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 224ºC |
|---|
Names
| Name | (2S,4S)-2-amino-4-benzylpentanedioic acid |
|---|
Chemical & Physical Properties
| Density | 1.303g/cm3 |
|---|
| Boiling Point | 446.8ºC at 760mmHg |
|---|
| Molecular Formula | C12H15NO4 |
|---|
| Molecular Weight | 237.25200 |
|---|
| Flash Point | 224ºC |
|---|
| Exact Mass | 237.10000 |
|---|
| PSA | 100.62000 |
|---|
| LogP | 1.43220 |
|---|
| Vapour Pressure | 9.12E-09mmHg at 25°C |
|---|
| Index of Refraction | 1.584 |
|---|
| InChIKey | ATCFYQUZTYQTJN-UWVGGRQHSA-N |
|---|
| SMILES | NC(CC(Cc1ccccc1)C(=O)O)C(=O)O |
|---|
