Introduction:Basic information about CAS 75108-34-8|e-1,1,1,5,5,5-hexafluoro-4-(trimethylsiloxy)-3-pentene-2-one, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | e-1,1,1,5,5,5-hexafluoro-4-(trimethylsiloxy)-3-pentene-2-one |
|---|
| CAS Number | 75108-34-8 | Molecular Weight | 280.24000 |
|---|
| Density | 1.239g/cm3 | Boiling Point | 129ºC |
|---|
| Molecular Formula | C8H10F6O2Si | Melting Point | / |
|---|
| MSDS | / | Flash Point | 58.4ºC |
|---|
Names
| Name | e-1,1,1,5,5,5-hexafluoro-4-(trimethylsiloxy)-3-pentene-2-one |
|---|
Chemical & Physical Properties
| Density | 1.239g/cm3 |
|---|
| Boiling Point | 129ºC |
|---|
| Molecular Formula | C8H10F6O2Si |
|---|
| Molecular Weight | 280.24000 |
|---|
| Flash Point | 58.4ºC |
|---|
| Exact Mass | 280.03500 |
|---|
| PSA | 26.30000 |
|---|
| LogP | 3.41550 |
|---|
| Index of Refraction | 1.364 |
|---|
| InChIKey | ZPDRURCPUBSLNQ-GQCTYLIASA-N |
|---|
| SMILES | C[Si](C)(C)OC(=CC(=O)C(F)(F)F)C(F)(F)F |
|---|