Introduction:Basic information about CAS 95630-75-4|ethyl 3-exo-aminobicyclo[2.2.1]heptane-2-exo-carboxylate hydrochloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | ethyl 3-exo-aminobicyclo[2.2.1]heptane-2-exo-carboxylate hydrochloride |
|---|
| CAS Number | 95630-75-4 | Molecular Weight | 219.70800 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C10H18ClNO2 | Melting Point | 150ºC |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | ethyl 3-exo-aminobicyclo[2.2.1]heptane-2-exo-carboxylate hydrochloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | 150ºC |
|---|
| Molecular Formula | C10H18ClNO2 |
|---|
| Molecular Weight | 219.70800 |
|---|
| Exact Mass | 219.10300 |
|---|
| PSA | 52.32000 |
|---|
| LogP | 2.42520 |
|---|
| InChIKey | GUZMBZLNPJWBTA-IOIMWAKYSA-N |
|---|
| SMILES | CCOC(=O)C1C2CCC(C2)C1N.Cl |
|---|
Safety Information
| Safety Phrases | S24/25 |
|---|
| HS Code | 2922499990 |
|---|
Customs
| HS Code | 2922499990 |
|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| ethyl exo-3-aminobicyclo<2.2.1>heptane-2-exo-carboxylate hydrochloride |
| ethyl diexo-3-aminobicyclo[2.2.1]hept-5-ene-2-carboxylate hydrochloride |
| ethyl exo-3-aminobicyclo<2.2.1>hept-5-ene-2-exo-carboxylate hydrochloride |
| Ethyl exo,exo-3-aminobicyclo[2.2.1]hept-5-ene-2-carboxylate |
| MFCD00144273 |
| 3-ethoxycarbonylbicyclo[2.2.1]hept-5-en-2-yl-ammonium chloride |
| ethyl diexo-3-aminobicyclo[2.2.1]heptane-2-carboxylate hydrochloride |
| ethyl exo-3-aminobicyclo<2.2.1>heptane-exo-2-carboxylate hydrochloride |
| Ethyl exo-aminobicyclo<2.2.1>hept-5-ene-2-exo-carboxylate |
| ethyl exo-3-aminobicyclo<2.2.1>hept-5-ene-exo-2-carboxylate hydrochloride |
| (rac-di-exo)-3-amino-bicyclo[2.2.1]heptane-2-carboxylic acid ethyl ester hydrochloride |