Introduction：Basic information about CAS 95695-47-9|n-(2,4-dichlorophenyl)maleamic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | n-(2,4-dichlorophenyl)maleamic acid |
|---|
| CAS Number | 95695-47-9 | Molecular Weight | 260.07300 |
|---|
| Density | 1.551g/cm3 | Boiling Point | 481.3ºC at 760mmHg |
|---|
| Molecular Formula | C10H7Cl2NO3 | Melting Point | 177-180ºC |
|---|
| MSDS | / | Flash Point | 244.9ºC |
|---|
Names
| Name | n-(2,4-dichlorophenyl)maleamic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.551g/cm3 |
|---|
| Boiling Point | 481.3ºC at 760mmHg |
|---|
| Melting Point | 177-180ºC |
|---|
| Molecular Formula | C10H7Cl2NO3 |
|---|
| Molecular Weight | 260.07300 |
|---|
| Flash Point | 244.9ºC |
|---|
| Exact Mass | 258.98000 |
|---|
| PSA | 66.40000 |
|---|
| LogP | 2.64570 |
|---|
| Index of Refraction | 1.651 |
|---|
| InChIKey | WFWKZRKAECLVSE-ARJAWSKDSA-N |
|---|
| SMILES | O=C(O)C=CC(=O)Nc1ccc(Cl)cc1Cl |
|---|
Safety Information
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-36 |
|---|
Synonyms
| Acetonitrile,[(2,4-dichlorophenyl)amino] |
| N-(2,4-dichloro-phenyl)-glycine nitrile |
| N-(2,4-Dichlor-phenyl)-maleamidsaeure |
| 2,4-dichloroanilinoacetonitrile |
| N-(2,4-Dichlor-phenyl)-glycin-nitril |
| MFCD00082905 |
| N-(2,4-dichloro-phenyl)-maleamic acid |
| <2,4-Dichlor-phenyl>-acetonitril |
