CAS 95715-87-0|(S)-Garner's Aldehyde
Introduction：Basic information about CAS 95715-87-0|(S)-Garner's Aldehyde, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (S)-Garner's Aldehyde | ||
|---|---|---|---|
| CAS Number | 95715-87-0 | Molecular Weight | 229.273 |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 302.7±42.0 °C at 760 mmHg |
| Molecular Formula | C11H19NO4 | Melting Point | / |
| MSDS | ChineseUSA | Flash Point | 136.9±27.9 °C |
| Symbol | GHS07 | Signal Word | Warning |
Names
| Name | (R)-tert-Butyl 4-formyl-2,2-dimethyloxazolidine-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 302.7±42.0 °C at 760 mmHg |
| Molecular Formula | C11H19NO4 |
| Molecular Weight | 229.273 |
| Flash Point | 136.9±27.9 °C |
| Exact Mass | 229.131409 |
| PSA | 55.84000 |
| LogP | 1.15 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.500 |
| InChIKey | PNJXYVJNOCLJLJ-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N1C(C=O)COC1(C)C |
Safety Information
| Symbol | GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | 37/39-26-36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2934999090 |
Customs
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
Articles1
More Articles| Gamma-fluorinated analogues of glutamic acid and glutamine. Amino Acids 24 , 245-261, (2003) Gamma-fluorinated analogues of glutamic acid and glutamine are compounds of biological interest. Syntheses of such compounds are extensively reviewed in this article. 4-fluoroglutamic acid was prepare... |
Synonyms
| (4S)-2,2-Dimethyl-1,3-oxazolidine-4-carboxaldehyde, N-BOC protected |
| (S)-4-Formyl-2,2-dimethyl-oxazolidine-3-carboxylic tert-butyl ester |
| tert-Butyl (4R)-4-formyl-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| Garner's aldehyde |
| tert-Butyl (4S)-4-formyl-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| (R)-4-Formyl-2,2-dimethyl-oxazolidine-3-carboxylic acid tert-butyl ester |
| tert-Butyl-(4S)-4-formyl-2,2-dimethyl-1,3-oxazolidin-3-carboxylat |
| (4S)-4-formyl-2,2-dimethyl-3-oxazolidinecarboxylic acid tert-butyl ester |
| (-)-Garner's Aldehyde |
| 2-Methyl-2-propanyl (4S)-4-formyl-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| (−)-N-Boc-N,O-isopropylidene-L-serinal |
| 3-Oxazolidinecarboxylic acid, 4-formyl-2,2-dimethyl-, 1,1-dimethylethyl ester, (4R)- |
| 3-Oxazolidinecarboxylic acid, 4-formyl-2,2-dimethyl-, 1,1-dimethylethyl ester, (4S)- |
| MFCD00674064 |
| 2-Methyl-2-propanyl (4R)-4-formyl-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| (R)-Garner aldehyde |
| Garners aldehyde |
| (-)-N-Boc-N,O-isopropylidene-L-serinal |
| (4S)-2,2-Dimethyl-1,3-oxazolidine-4-carboxaldehyde N-BOC protected |
| TERT-BUTYL (R)-(+)-4-FORMYL-2,2-DIMETHYL-3-OXAZOLIDINECARBOXYLATE |
| (4S)-4-formyl-2,2-dimethyl-oxazolidine-3-carboxylic acid tert-butyl ester |
| (R)-3-Boc-4-formyl-2,2-dimethyl-1,3-oxazolidine |
