Introduction：Basic information about CAS 99102-04-2|(R*,S*)-3-Chloro-α-[1-[(1,1-dimethylethyl)amino]ethyl]benzenemethanol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (R*,S*)-3-Chloro-α-[1-[(1,1-dimethylethyl)amino]ethyl]benzenemethanol |
|---|
| CAS Number | 99102-04-2 | Molecular Weight | 241.75700 |
|---|
| Density | 1.078 | Boiling Point | 347.2ºC at 760 mmHg |
|---|
| Molecular Formula | C13H20ClNO | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | (R*,S*)-3-Chloro-α-[1-[(1,1-dimethylethyl)amino]ethyl]benzenemethanol |
|---|
Chemical & Physical Properties
| Density | 1.078 |
|---|
| Boiling Point | 347.2ºC at 760 mmHg |
|---|
| Molecular Formula | C13H20ClNO |
|---|
| Molecular Weight | 241.75700 |
|---|
| Exact Mass | 241.12300 |
|---|
| PSA | 32.26000 |
|---|
| LogP | 3.54090 |
|---|
| Index of Refraction | 1.527 |
|---|
| InChIKey | NDPTTXIBLSWNSF-BXKDBHETSA-N |
|---|
| SMILES | CC(NC(C)(C)C)C(O)c1cccc(Cl)c1 |
|---|
