Introduction：Basic information about CAS 551-27-9|propicillin, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | propicillin |
|---|
| CAS Number | 551-27-9 | Molecular Weight | 378.44300 |
|---|
| Density | 1.38g/cm3 | Boiling Point | 675.5ºC at 760mmHg |
|---|
| Molecular Formula | C18H22N2O5S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 362.3ºC |
|---|
Names
| Name | propicillin |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.38g/cm3 |
|---|
| Boiling Point | 675.5ºC at 760mmHg |
|---|
| Molecular Formula | C18H22N2O5S |
|---|
| Molecular Weight | 378.44300 |
|---|
| Flash Point | 362.3ºC |
|---|
| Exact Mass | 378.12500 |
|---|
| PSA | 124.73000 |
|---|
| LogP | 2.25390 |
|---|
| Index of Refraction | 1.628 |
|---|
| InChIKey | HOCWPKXKMNXINF-XQERAMJGSA-N |
|---|
| SMILES | CCC(Oc1ccccc1)C(=O)NC1C(=O)N2C1SC(C)(C)C2C(=O)O |
|---|
Synonyms
| (2S,5R,6R)-3,3-Dimethyl-7-oxo-6-[(2-phenoxybutanoyl)amino]-4-thia -1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| A-pimaric acid |
| B-Pimaric Acid |
