Introduction:Basic information about CAS 2103-90-4|4-P-TOLYLTHIAZOL-2-OL, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-P-TOLYLTHIAZOL-2-OL |
|---|
| CAS Number | 2103-90-4 | Molecular Weight | 191.25000 |
|---|
| Density | 1.254 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C10H9NOS | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 4-(4-Methylphenyl)-1,3-thiazol-2(3H)-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.254 g/cm3 |
|---|
| Molecular Formula | C10H9NOS |
|---|
| Molecular Weight | 191.25000 |
|---|
| Exact Mass | 191.04000 |
|---|
| PSA | 61.36000 |
|---|
| LogP | 2.82410 |
|---|
| InChIKey | FKFCXWOMNWZZQG-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(-c2csc(=O)[nH]2)cc1 |
|---|
Safety Information
Customs
| HS Code | 2934100090 |
|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
|---|
Synonyms
| 4-p-tolyl-3,4,5,6,7,8-hexahydro-1H-quinazoline-2-thione |
| 4-p-Tolyl-3H-thiazol-2-on |
| 2(1H)-Quinazolinethione,3,4,5,6,7,8-hexahydro-4-(4-methylphenyl) |
| 4-(4-methylphenyl)-2-oxo-thiazole |
| 4-p-tolyl-3H-thiazol-2-one |
| 4-(p-methylphenyl)-1,2,3,4,5,6,7,8-octahydroquinazoline-2-thione |