Introduction:Basic information about CAS 6882-99-1|sempervirene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | sempervirene |
|---|
| CAS Number | 6882-99-1 | Molecular Weight | 272.344 |
|---|
| Density | 1.28g/cm3 | Boiling Point | 591.6ºC at 760 mmHg |
|---|
| Molecular Formula | C19H16N2 | Melting Point | 271ºC |
|---|
| MSDS | / | Flash Point | 311.6ºC |
|---|
Names
| Name | 16,17,18,19-tetrahydro-3H-yohimban-13-ium |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.28g/cm3 |
|---|
| Boiling Point | 591.6ºC at 760 mmHg |
|---|
| Melting Point | 271ºC |
|---|
| Molecular Formula | C19H16N2 |
|---|
| Molecular Weight | 272.344 |
|---|
| Flash Point | 311.6ºC |
|---|
| Exact Mass | 272.131348 |
|---|
| PSA | 17.30000 |
|---|
| LogP | 4.51950 |
|---|
| Index of Refraction | 1.73 |
|---|
| InChIKey | UQVUEULZDJRMJR-UHFFFAOYSA-O |
|---|
| SMILES | c1ccc2c(c1)[nH]c1c2cc[n+]2cc3c(cc12)CCCC3 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | 23/24/25 |
|---|
| Safety Phrases | 22-36/37/39 |
|---|
Synonyms
| 3,4,5,6,14,15,20,21-Octadehydroyohimban-4-ium-1-ide |
| 3,4,5,6,14,15,20,21-octadehydroyohimban-4-ium |
| Yohimban-4-ium, 3,4,5,6,14,15,20,21-octadehydro-, inner salt |
| 2,3,4,13-tetrahydro-1h-benz[g]indolo[2,3-a]quinolizin-6-ium |
| 2,3,4,13-Tetrahydro-1H-benz(g)indolo(2,3)quinolizin-6-ium |
| sempervirene |
| 3,4,5,6,14,15,20,21-Octadehydroyohimbanium |