Introduction：Basic information about CAS 42749-49-5|4-carbamoyl-2-[(4-methylphenyl)sulfonylamino]butanoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-carbamoyl-2-[(4-methylphenyl)sulfonylamino]butanoic acid |
|---|
| CAS Number | 42749-49-5 | Molecular Weight | 300.33100 |
|---|
| Density | 1.376g/cm3 | Boiling Point | 607.3ºC at 760 mmHg |
|---|
| Molecular Formula | C12H16N2O5S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 321.1ºC |
|---|
Names
| Name | 5-amino-2-[(4-methylphenyl)sulfonylamino]-5-oxopentanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.376g/cm3 |
|---|
| Boiling Point | 607.3ºC at 760 mmHg |
|---|
| Molecular Formula | C12H16N2O5S |
|---|
| Molecular Weight | 300.33100 |
|---|
| Flash Point | 321.1ºC |
|---|
| Exact Mass | 300.07800 |
|---|
| PSA | 134.94000 |
|---|
| LogP | 2.16400 |
|---|
| Index of Refraction | 1.577 |
|---|
| InChIKey | YDNYEJZZJXFADP-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(S(=O)(=O)NC(CCC(N)=O)C(=O)O)cc1 |
|---|
Safety Information
Customs
| HS Code | 2935009090 |
|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|---|
Synonyms
| N2-<(4-methylphenyl)sulfonyl>-L-glutamine |
| (-)-N-[(4-methylphenyl)sulfonyl]-D-glutamine |
| N-tosyl-L-glutamine |
| 4-Carbamoyl-2-(toluene-4-sulfonylamino)-butyric acid |
| N-(p-tolylsulfonyl)glutamine |
| N-(p-Toluenesulfonyl)-L-glutamine |
| 5-amino-2(S)-{[(4-methylphenyl)sulfonyl]amino}-5-oxopentanoic acid |
| N2-(toluene-4-sulfonyl)-L-glutamine |
