Introduction：Basic information about CAS 59156-21-7|2-(4-Nitrophenyl)thiophene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(4-Nitrophenyl)thiophene |
|---|
| CAS Number | 59156-21-7 | Molecular Weight | 205.23300 |
|---|
| Density | 1.315 g/cm3 | Boiling Point | 338.8ºC at 760 mmHg |
|---|
| Molecular Formula | C10H7NO2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 2-(4-Nitrophenyl)thiophene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.315 g/cm3 |
|---|
| Boiling Point | 338.8ºC at 760 mmHg |
|---|
| Molecular Formula | C10H7NO2S |
|---|
| Molecular Weight | 205.23300 |
|---|
| Exact Mass | 205.02000 |
|---|
| PSA | 74.06000 |
|---|
| LogP | 3.84650 |
|---|
| Index of Refraction | 1.633 |
|---|
| InChIKey | YRKAJCGUTWECCT-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1ccc(-c2cccs2)cc1 |
|---|
Synonyms
| 1-(thien-2-yl)-4-nitrobenzene |
| 1-(2-thienyl)-4-nitrobenzene |
| Thiophene,2-(4-nitrophenyl) |
| 4-thiophen-2-ylnitrobenzene |
| 1-nitro-4-(thien-2-yl)benzene |
| 2-(4-Nitro-phenyl)-thiophene |
| 2-(p-nitrophenyl)thiophene |
