Introduction:Basic information about CAS 19231-06-2|bis(4-methoxyphenyl)iodanium bromide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | bis(4-methoxyphenyl)iodanium bromide |
|---|
| CAS Number | 19231-06-2 | Molecular Weight | 421.06800 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C14H14BrIO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | bis(4-methoxyphenyl)iodanium,bromide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C14H14BrIO2 |
|---|
| Molecular Weight | 421.06800 |
|---|
| Exact Mass | 419.92200 |
|---|
| PSA | 18.46000 |
|---|
| InChIKey | YDSNSDXMWRVLLI-UHFFFAOYSA-M |
|---|
| SMILES | COc1ccc([I+]c2ccc(OC)cc2)cc1.[Br-] |
|---|
Safety Information
Customs
| HS Code | 2909309090 |
|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| bis(4-methoxyphenyl)iodanium bromide |
| di(4-methoxyphenyl)iodonium bromide |
| bis(4-methoxyphenyl)iodonium bromide |
| Bis-(4-methoxy-phenyl)-jodonium,Bromid |
| 4,4'-dimethoxydiphenyliodonium bromide |
| Bis(p-methoxyphenyl)iodonium bromide |
| Iodonium,bis(4-methoxyphenyl)-, bromide (1:1) |