Introduction：Basic information about CAS 73734-07-3|ethyl 4-(1H-benzimidazol-2-ylamino)piperidine-1-carboxylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | ethyl 4-(1H-benzimidazol-2-ylamino)piperidine-1-carboxylate |
|---|
| CAS Number | 73734-07-3 | Molecular Weight | 288.34500 |
|---|
| Density | 1.297g/cm3 | Boiling Point | 482.1ºC at 760 mmHg |
|---|
| Molecular Formula | C15H20N4O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 245.4ºC |
|---|
Names
| Name | ethyl 4-(1H-benzimidazol-2-ylamino)piperidine-1-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.297g/cm3 |
|---|
| Boiling Point | 482.1ºC at 760 mmHg |
|---|
| Molecular Formula | C15H20N4O2 |
|---|
| Molecular Weight | 288.34500 |
|---|
| Flash Point | 245.4ºC |
|---|
| Exact Mass | 288.15900 |
|---|
| PSA | 73.48000 |
|---|
| LogP | 1.95550 |
|---|
| Index of Refraction | 1.657 |
|---|
| InChIKey | IMLIPHSGYFXWAA-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)N1CCC(Nc2nc3ccccc3[nH]2)CC1 |
|---|
Synonyms
| EINECS 277-580-9 |
| ethyl 4-(1H-benzo[d]imidazol-2-ylamino)piperidin-1-carboxylate |
| ethyl 4-[(3H-imidazo[4,5-b]pyridin-2-yl)amino]-1-piperdinecarboxylate |
| ethyl 4-(1H-benzimidazol-2-ylamino)-1-piperidine-carboxylate |
| 4-(1H-Benzimidazol-2-ylamino)-1-(ethoxycarbonyl)piperidine |
| (1H-benzimidazol-2-yl)-(1-ethoxycarbonyl-piperidin-4-yl)amine |
