Introduction：Basic information about CAS 260417-56-9|(2-BROMO-2-ETHYLBUTYRYL)UREA, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (2-BROMO-2-ETHYLBUTYRYL)UREA |
|---|
| CAS Number | 260417-56-9 | Molecular Weight | 263.09000 |
|---|
| Density | 1.545g/cm3 | Boiling Point | 411.9ºC at 760 mmHg |
|---|
| Molecular Formula | C11H7BrN2O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 202.9ºC |
|---|
Names
| Name | (2-bromopyridin-4-yl)-pyridin-3-ylmethanone |
|---|
Chemical & Physical Properties
| Density | 1.545g/cm3 |
|---|
| Boiling Point | 411.9ºC at 760 mmHg |
|---|
| Molecular Formula | C11H7BrN2O |
|---|
| Molecular Weight | 263.09000 |
|---|
| Flash Point | 202.9ºC |
|---|
| Exact Mass | 261.97400 |
|---|
| PSA | 42.85000 |
|---|
| LogP | 2.47010 |
|---|
| Vapour Pressure | 5.38E-07mmHg at 25°C |
|---|
| Index of Refraction | 1.621 |
|---|
| InChIKey | IOVJKGWSRSFDRT-UHFFFAOYSA-N |
|---|
| SMILES | O=C(c1cccnc1)c1ccnc(Br)c1 |
|---|
