Introduction：Basic information about CAS 19541-95-8|3-(4-Methoxyphenyl)-1H-pyrazol-5-amine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-(4-Methoxyphenyl)-1H-pyrazol-5-amine |
|---|
| CAS Number | 19541-95-8 | Molecular Weight | 189.214 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 466.4±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H11N3O | Melting Point | 143-145°C |
|---|
| MSDS | ChineseUSA | Flash Point | 235.9±27.3 °C |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | 5-(4-methoxyphenyl)-1H-pyrazol-3-amine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 466.4±40.0 °C at 760 mmHg |
|---|
| Melting Point | 143-145°C |
|---|
| Molecular Formula | C10H11N3O |
|---|
| Molecular Weight | 189.214 |
|---|
| Flash Point | 235.9±27.3 °C |
|---|
| Exact Mass | 189.090210 |
|---|
| PSA | 63.93000 |
|---|
| LogP | 1.15 |
|---|
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.630 |
|---|
| InChIKey | UPAGEJODHNVJNM-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(-c2cc(N)n[nH]2)cc1 |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36/37/39-S36 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| HS Code | 2933199090 |
|---|
Customs
| HS Code | 2933199090 |
|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 5-(4-Methoxy-phenyl)-2H-pyrazol-3-ylamine |
| 3-Amino-5-(4-methoxyphenyl)pyrazole |
| 5-Amino-3-(4-methoxyphenyl)pyrazole |
| 1H-Pyrazol-3-amine, 5-(4-methoxyphenyl)- |
| 1H-Pyrazol-5-amine, 3-(4-methoxyphenyl)- |
| 3-(4'-methoxyphenyl)-5-aminopyrazole |
| 5-(4-methoxyphenyl)-1H-pyrazole-3-amine |
| 5-(4-Methoxyphenyl)-1H-pyrazol-3-amine |
| 3-(4-Methoxyphenyl)-1H-pyrazol-5-amine |
| MFCD00462192 |
| 3-Amino-5-(4-methoxyphenyl)-1H-pyrazole |
| 5-Amino-3-(4-methoxyphenyl)-1H-pyrazole |
