Introduction：Basic information about CAS 111770-91-3|2-METHYL-5-PYRIDINETRIFLUOROMETHANESULF&, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-METHYL-5-PYRIDINETRIFLUOROMETHANESULF& |
|---|
| CAS Number | 111770-91-3 | Molecular Weight | 241.18800 |
|---|
| Density | 1.412 g/mL at 25ºC(lit.) | Boiling Point | 80-82ºC1.9 mm Hg(lit.) |
|---|
| Molecular Formula | C7H6F3NO3S | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | 197.6 °F |
|---|
| Symbol |
GHS06 | Signal Word | Danger |
|---|
Names
| Name | (6-methylpyridin-3-yl) trifluoromethanesulfonate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.412 g/mL at 25ºC(lit.) |
|---|
| Boiling Point | 80-82ºC1.9 mm Hg(lit.) |
|---|
| Molecular Formula | C7H6F3NO3S |
|---|
| Molecular Weight | 241.18800 |
|---|
| Exact Mass | 241.00200 |
|---|
| PSA | 64.64000 |
|---|
| LogP | 2.69920 |
|---|
| Vapour Pressure | 0.013mmHg at 25°C |
|---|
| Index of Refraction | n20/D 1.442(lit.) |
|---|
| InChIKey | NSSSVJYQTZRVMH-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(OS(=O)(=O)C(F)(F)F)cn1 |
|---|
Safety Information
| Symbol |
GHS06 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H301-H315-H319-H335 |
|---|
| Precautionary Statements | P261-P301 + P310-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
|---|
| Hazard Codes | T |
|---|
| Risk Phrases | R25 |
|---|
| Safety Phrases | S26 |
|---|
| RIDADR | UN 2811 6.1/PG 3 |
|---|
| HS Code | 2933399090 |
|---|
| Flash Point(F) | 197.6 °F |
|---|
| Flash Point(C) | 92 °C |
|---|
Customs
| HS Code | 2933399090 |
|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 2-Methyl-5-pyridinetrifluoromethanesulfonate |
| trifluoromethanesulfonic acid 2-methyl-5-pyridinyl ester |
| 6-methylpyridin-3-yl trifluoromethanesulfonate |
| MFCD06798124 |
| trifluoromethanesulfonic acid 2-methylpyridin-5-yl ester |
| trifluoromethanesulfonic acid 6-methylpyridin-3-yl ester |
| Methanesulfonic acid,trifluoro-,6-methyl-3-pyridinyl ester |
| 2-methyl-5-(trifluoromethylsulfonyloxy)pyridine |
| trifluoromethanesulfonic acid 6-methyl-3-pyridinyl ester |
| (2-methylpyridine-5-yl)trifluoromethanesulfonate |
| 2-Methyl-5-pyridyl triflate |
