Introduction:Basic information about CAS 143262-10-6|1-BOC-INDOLINE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-BOC-INDOLINE |
|---|
| CAS Number | 143262-10-6 | Molecular Weight | 219.28000 |
|---|
| Density | 1.114g/cm3 | Boiling Point | 83ºC (0.1 torr) |
|---|
| Molecular Formula | C13H17NO2 | Melting Point | 46-50ºC |
|---|
| MSDS | ChineseUSA | Flash Point | 138ºC |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | tert-butyl 2,3-dihydroindole-1-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.114g/cm3 |
|---|
| Boiling Point | 83ºC (0.1 torr) |
|---|
| Melting Point | 46-50ºC |
|---|
| Molecular Formula | C13H17NO2 |
|---|
| Molecular Weight | 219.28000 |
|---|
| Flash Point | 138ºC |
|---|
| Exact Mass | 219.12600 |
|---|
| PSA | 29.54000 |
|---|
| LogP | 3.04920 |
|---|
| Vapour Pressure | 0.000869mmHg at 25°C |
|---|
| Index of Refraction | 1.544 |
|---|
| InChIKey | GWAXLDLPPZPQLO-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)N1CCc2ccccc21 |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| HS Code | 2933990090 |
|---|
Customs
| HS Code | 2933990090 |
|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| tert-Butyl indoline-1-carboxylate |
| 1-tert-butyloxycarbonyl-2,3-dihydro-1H-indole |
| 2,3-dihydroindole-1-carboxylic acid tert-butyl ester |
| N-tert-butoxycarbonyl indoline |
| 1,1-dimethylethyl 2,3-dihydro-1H-indole-1-carboxylate |
| N-Boc-indoline |
| N-tert-butoxycarbonyl-2,3-dihydroindole |
| tert-butyl indolinecarboxylate |
| 1-BOC-INDOLINE |
| MFCD01318399 |