Introduction：Basic information about CAS 21388-97-6|3-Nitrobenzyl acetate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Nitrobenzyl acetate |
|---|
| CAS Number | 21388-97-6 | Molecular Weight | 195.17200 |
|---|
| Density | 1.266g/cm3 | Boiling Point | 302.2ºC at 760 mmHg |
|---|
| Molecular Formula | C9H9NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 139.5ºC |
|---|
Names
| Name | 3-Nitrobenzyl acetate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.266g/cm3 |
|---|
| Boiling Point | 302.2ºC at 760 mmHg |
|---|
| Molecular Formula | C9H9NO4 |
|---|
| Molecular Weight | 195.17200 |
|---|
| Flash Point | 139.5ºC |
|---|
| Exact Mass | 195.05300 |
|---|
| PSA | 72.12000 |
|---|
| LogP | 2.18110 |
|---|
| Vapour Pressure | 0.001mmHg at 25°C |
|---|
| Index of Refraction | 1.545 |
|---|
| InChIKey | WNVPZUAAKWXDNS-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)OCc1cccc([N+](=O)[O-])c1 |
|---|
Synonyms
| (m-nitrophenyl)methanediol diacetate |
| (3-nitrophenyl)methanediyl diacetate |
| 3-NO2C6H4CH(OAc)2 |
| acetic acid-(3-nitro-benzyl ester) |
| (m-nitrobenzyl)acetate |
| acetyloxy(3-nitrophenyl)methyl acetate |
| 3-NO2-C6H4CH2OAc |
| 1,1-diacetoxy-1-(3-nitrophenyl)-methane |
| 3-Nitrobenzylidene di(acetate) |
| Essigsaeure-(3-nitro-benzylester) |
