Introduction：Basic information about CAS 424-89-5|Clomegestone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Clomegestone |
|---|
| CAS Number | 424-89-5 | Molecular Weight | 418.95400 |
|---|
| Density | 1.21g/cm3 | Boiling Point | 518.1ºC at 760mmHg |
|---|
| Molecular Formula | C24H31ClO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 169.3ºC |
|---|
Names
| Name | (16α)-6-Chloro-16-methyl-3,20-dioxopregna-4,6-dien-17-yl acetate |
|---|
Chemical & Physical Properties
| Density | 1.21g/cm3 |
|---|
| Boiling Point | 518.1ºC at 760mmHg |
|---|
| Molecular Formula | C24H31ClO4 |
|---|
| Molecular Weight | 418.95400 |
|---|
| Flash Point | 169.3ºC |
|---|
| Exact Mass | 418.19100 |
|---|
| PSA | 60.44000 |
|---|
| LogP | 4.99770 |
|---|
| Vapour Pressure | 7.71E-11mmHg at 25°C |
|---|
| Index of Refraction | 1.557 |
|---|
| InChIKey | WWSKHPDYSWDMNC-YRNSVOBJSA-N |
|---|
| SMILES | CC(=O)OC1(C(C)=O)C(C)CC2C3C=C(Cl)C4=CC(=O)CCC4(C)C3CCC21C |
|---|
