Introduction：Basic information about CAS 54063-33-1|Cloxestradiol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Cloxestradiol |
|---|
| CAS Number | 54063-33-1 | Molecular Weight | 419.77000 |
|---|
| Density | 1.39g/cm3 | Boiling Point | 503.8ºC at 760mmHg |
|---|
| Molecular Formula | C20H25Cl3O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 258.5ºC |
|---|
Names
| Name | (17β)-17-(2,2,2-Trichloro-1-hydroxyethoxy)estra-1,3,5(10)-trien-3 -ol |
|---|
Chemical & Physical Properties
| Density | 1.39g/cm3 |
|---|
| Boiling Point | 503.8ºC at 760mmHg |
|---|
| Molecular Formula | C20H25Cl3O3 |
|---|
| Molecular Weight | 419.77000 |
|---|
| Flash Point | 258.5ºC |
|---|
| Exact Mass | 418.08700 |
|---|
| PSA | 49.69000 |
|---|
| LogP | 5.32210 |
|---|
| Index of Refraction | 1.612 |
|---|
| InChIKey | JVLHMVXGPLKLFV-AJUWMHLFSA-N |
|---|
| SMILES | CC12CCC3c4ccc(O)cc4CCC3C1CCC2OC(O)C(Cl)(Cl)Cl |
|---|
