Introduction：Basic information about CAS 150443-71-3|2,6-ditert-butyl-4-[3-(pyridin-3-ylmethoxy)propyl]phenol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,6-ditert-butyl-4-[3-(pyridin-3-ylmethoxy)propyl]phenol |
|---|
| CAS Number | 150443-71-3 | Molecular Weight | 355.51400 |
|---|
| Density | 1.023g/cm3 | Boiling Point | 442.3ºC at 760mmHg |
|---|
| Molecular Formula | C23H33NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 221.3ºC |
|---|
Names
| Name | 2,6-ditert-butyl-4-[3-(pyridin-3-ylmethoxy)propyl]phenol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.023g/cm3 |
|---|
| Boiling Point | 442.3ºC at 760mmHg |
|---|
| Molecular Formula | C23H33NO2 |
|---|
| Molecular Weight | 355.51400 |
|---|
| Flash Point | 221.3ºC |
|---|
| Exact Mass | 355.25100 |
|---|
| PSA | 42.35000 |
|---|
| LogP | 5.53160 |
|---|
| Vapour Pressure | 1.95E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.534 |
|---|
| InChIKey | YNBBIPPQHYZTQF-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)c1cc(CCCOCc2cccnc2)cc(C(C)(C)C)c1O |
|---|
Synonyms
| Nicanartine |
| MRZ-3/124 |
| 2,6-Di-tert-butyl-4-(3-(3-pyridylmethoxy)propyl)phenol |
| UNII-85DV2PAF78 |
