Introduction:Basic information about CAS 5484-20-8|9H-Xanthene-9-carbohydrazide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 9H-Xanthene-9-carbohydrazide |
|---|
| CAS Number | 5484-20-8 | Molecular Weight | 240.25700 |
|---|
| Density | 1.303g/cm3 | Boiling Point | 451.5ºC at 760mmHg |
|---|
| Molecular Formula | C14H12N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 9H-Xanthene-9-carbohydrazide |
|---|
Chemical & Physical Properties
| Density | 1.303g/cm3 |
|---|
| Boiling Point | 451.5ºC at 760mmHg |
|---|
| Molecular Formula | C14H12N2O2 |
|---|
| Molecular Weight | 240.25700 |
|---|
| Exact Mass | 240.09000 |
|---|
| PSA | 67.84000 |
|---|
| LogP | 3.45470 |
|---|
| Index of Refraction | 1.648 |
|---|
| InChIKey | VDVNAWMSFFMKDT-UHFFFAOYSA-N |
|---|
| SMILES | NNC(=O)C1c2ccccc2Oc2ccccc21 |
|---|