CAS 542-40-5|β-Norbixin
Introduction:Basic information about CAS 542-40-5|β-Norbixin, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | β-Norbixin | ||
|---|---|---|---|
| CAS Number | 542-40-5 | Molecular Weight | 380.477 |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 640.4±28.0 °C at 760 mmHg |
| Molecular Formula | C24H28O4 | Melting Point | / |
| MSDS | / | Flash Point | 355.1±20.5 °C |
Names
| Name | (2E,4E,6E,8E,10E,12E,14E,16E,18E)-4,8,13,17-tetramethylicosa-2,4,6,8,10,12,14,16,18-nonaenedioic acid |
|---|---|
| Synonym | More Synonyms |
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 640.4±28.0 °C at 760 mmHg |
| Molecular Formula | C24H28O4 |
| Molecular Weight | 380.477 |
| Flash Point | 355.1±20.5 °C |
| Exact Mass | 380.198761 |
| PSA | 74.60000 |
| LogP | 5.81 |
| Vapour Pressure | 0.0±4.1 mmHg at 25°C |
| Index of Refraction | 1.567 |
| InChIKey | ZVKOASAVGLETCT-UOGKPENDSA-N |
| SMILES | CC(C=CC=C(C)C=CC(=O)O)=CC=CC=C(C)C=CC=C(C)C=CC(=O)O |
Synonyms
| 6,6′-diapo-ψ,ψ-carotenedioic acid |
| (2E,4E,6E,8E,10E,12E,14E,16E,18E)-4,8,13,17-Tetramethyl-2,4,6,8,10,12,14,16,18-icosanonaenedioic acid |
| all-trans-norbixin |
| Norbixen |
| E 160b |
| all-trans-6,6'-diapocarotene-6,6'-dioic acid |
| Norbixin |
| Annatto (E 160b) |
| all-trans norbixin |
| 6,6'-diapocarotene-6,6'-dioic acid |
| Norbixin (cis/trans mixture) |
| 2,4,6,8,10,12,14,16,18-Eicosanonaenedioic acid, 4,8,13,17-tetramethyl-, (2E,4E,6E,8E,10E,12E,14E,16E,18E)- |
| 9'-cis-6,6'-Diapocaroten-6,6'-disaeure |
| EINECS 208-810-8 |
| (2E,4E,6E,8E,10E,12E,14E,16E,18E)-4,8,13,17-tetramethylicosa-2,4,6,8,10,12,14,16,18-nonaenedioic acid |
