Introduction：Basic information about CAS 116170-30-0|thicyofen, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | thicyofen |
|---|
| CAS Number | 116170-30-0 | Molecular Weight | 244.72100 |
|---|
| Density | 1.58g/cm3 | Boiling Point | 476.8ºC at 760mmHg |
|---|
| Molecular Formula | C8H5ClN2OS2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 242.1ºC |
|---|
Names
| Name | thicyofen |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.58g/cm3 |
|---|
| Boiling Point | 476.8ºC at 760mmHg |
|---|
| Molecular Formula | C8H5ClN2OS2 |
|---|
| Molecular Weight | 244.72100 |
|---|
| Flash Point | 242.1ºC |
|---|
| Exact Mass | 243.95300 |
|---|
| PSA | 112.10000 |
|---|
| LogP | 3.13806 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.66 |
|---|
| InChIKey | GNOOAFGERMHQJE-UHFFFAOYSA-N |
|---|
| SMILES | CCS(=O)c1sc(C#N)c(Cl)c1C#N |
|---|
Synonyms
| 3-chloro-5-(ethylsulfinyl)-2,4-thiophenedicarbonitrile |
| Thicyofen [ISO] |
| Thicyofen |
| 3-chloro-5-(ethanesulfinyl)thiophene-2,4-dicarbonitrile |
| 2,4-Thiophenedicarbonitrile,3-chloro-5-(ethylsulfinyl) |
| 3-chloro-5-ethylsulfinylthiophene-2,4-dicarbonitrile |
