Introduction：Basic information about CAS 159751-47-0|Fmoc-Aad(otBu)-OH, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Fmoc-Aad(otBu)-OH |
|---|
| CAS Number | 159751-47-0 | Molecular Weight | 439.50100 |
|---|
| Density | 1.214g/cm3 | Boiling Point | 625.5ºC at 760mmHg |
|---|
| Molecular Formula | C25H29NO6 | Melting Point | 108-112ºC |
|---|
| MSDS | / | Flash Point | 332.1ºC |
|---|
Names
| Name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[(2-methylpropan-2-yl)oxy]-6-oxohexanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.214g/cm3 |
|---|
| Boiling Point | 625.5ºC at 760mmHg |
|---|
| Melting Point | 108-112ºC |
|---|
| Molecular Formula | C25H29NO6 |
|---|
| Molecular Weight | 439.50100 |
|---|
| Flash Point | 332.1ºC |
|---|
| Exact Mass | 439.19900 |
|---|
| PSA | 101.93000 |
|---|
| LogP | 4.88120 |
|---|
| Vapour Pressure | 1.64E-16mmHg at 25°C |
|---|
| Index of Refraction | 1.566 |
|---|
| InChIKey | FFLAQPKWVSSKJC-NRFANRHFSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)CCCC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
|---|
Safety Information
Synonyms
| (S)-2-Fmoc-aminohexanedioic acid 6-tert-butyl ester |
| Fmoc-Aad(OtBu) |
| (S)-2-Fmoc-Aminohexanedioic acid 6-tert-butyl ester |
| (S)-2-[((9H-fluoren-9-yl)methoxy)carbonylamino]-6-tert-butoxy-6-oxohexanoic acid |
| (S)-2-(Fmoc-Amino)-Hexanedioic Acid-6-T-Butyl Ester |
| Fmoc-Aad(tBu)-OH |
| Fmoc-Aad(Otbu)-OH |
| Fmoc-β-homo-Glu(OtBu)-OH |
