Introduction：Basic information about CAS 1204-29-1|1-ethyl-2,4-dinitrobenzene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-ethyl-2,4-dinitrobenzene |
|---|
| CAS Number | 1204-29-1 | Molecular Weight | 196.16000 |
|---|
| Density | 1.344g/cm3 | Boiling Point | 304.6ºC at 760mmHg |
|---|
| Molecular Formula | C8H8N2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 143.4ºC |
|---|
Names
| Name | 1-ethyl-2,4-dinitrobenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.344g/cm3 |
|---|
| Boiling Point | 304.6ºC at 760mmHg |
|---|
| Molecular Formula | C8H8N2O4 |
|---|
| Molecular Weight | 196.16000 |
|---|
| Flash Point | 143.4ºC |
|---|
| Exact Mass | 196.04800 |
|---|
| PSA | 91.64000 |
|---|
| LogP | 3.11180 |
|---|
| Vapour Pressure | 0.00156mmHg at 25°C |
|---|
| Index of Refraction | 1.584 |
|---|
| InChIKey | RPQSKHWNIKZEAI-UHFFFAOYSA-N |
|---|
| SMILES | CCc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
|---|
Synonyms
| 1-Aethyl-2,4-dinitro-benzol |
| 1-ethyl-2,4-dinitro-benzene |
| 2,4-Dinitro-1-ethyl-benzol |
| 1-Ethyl-2,4-dinitrobenzol |
| Benzene,1-ethyl-2,4-dinitro |
| 2,4-Dinitro-1-ethylbenzene |
| 2,4-dinitroethylbenzene |
