Introduction:Basic information about CAS 40140-16-7|ethyl 4-methoxybenzoylformate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | ethyl 4-methoxybenzoylformate |
|---|
| CAS Number | 40140-16-7 | Molecular Weight | 208.21100 |
|---|
| Density | 1.147g/cm3 | Boiling Point | 317.6ºC at 760 mmHg |
|---|
| Molecular Formula | C11H12O4 | Melting Point | / |
|---|
| MSDS | USA | Flash Point | 139.2ºC |
|---|
Names
| Name | ethyl 2-(4-methoxyphenyl)-2-oxoacetate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.147g/cm3 |
|---|
| Boiling Point | 317.6ºC at 760 mmHg |
|---|
| Molecular Formula | C11H12O4 |
|---|
| Molecular Weight | 208.21100 |
|---|
| Flash Point | 139.2ºC |
|---|
| Exact Mass | 208.07400 |
|---|
| PSA | 52.60000 |
|---|
| LogP | 1.44100 |
|---|
| Index of Refraction | 1.506 |
|---|
| InChIKey | FSFFJEWAYWRLFT-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)C(=O)c1ccc(OC)cc1 |
|---|
Synonyms
| 4-methoxyphenylglyoxylic acid ethyl ester |
| Ethyl 4-methoxybenzoylformate |
| MFCD00963513 |
| 4-methoxyphenylglyoxylate ethyl ester |