Introduction：Basic information about CAS 15286-98-3|4-(Acryloylamino)benzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(Acryloylamino)benzoic acid |
|---|
| CAS Number | 15286-98-3 | Molecular Weight | 191.183 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 436.9±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H9NO3 | Melting Point | / |
|---|
| MSDS | USA | Flash Point | 218.0±26.5 °C |
|---|
Names
| Name | 4-(prop-2-enoylamino)benzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 436.9±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H9NO3 |
|---|
| Molecular Weight | 191.183 |
|---|
| Flash Point | 218.0±26.5 °C |
|---|
| Exact Mass | 191.058243 |
|---|
| PSA | 66.40000 |
|---|
| LogP | 1.71 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.625 |
|---|
| InChIKey | MNIDYHCRWJBKLX-UHFFFAOYSA-N |
|---|
| SMILES | C=CC(=O)Nc1ccc(C(=O)O)cc1 |
|---|
Safety Information
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| N-Acryloyl-p-aminobenzoic Acid |
| 4-Acryloylamino-benzoesaeure |
| 4-(prop-2-enamido)benzoic acid |
| p-((1-Oxoallyl)amino)benzoic acid |
| 4-acryloylamino-benzoic acid |
| 4-(acrylamido)benzoic acid |
| Benzoic acid, 4-[(1-oxo-2-propen-1-yl)amino]- |
| 4-(Acryloylamino)benzoic acid |
