Introduction:Basic information about CAS 152873-79-5|1,5-Naphthalenebis(trifluoromethanesulfonate), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,5-Naphthalenebis(trifluoromethanesulfonate) |
|---|
| CAS Number | 152873-79-5 | Molecular Weight | 424.293 |
|---|
| Density | 1.7±0.1 g/cm3 | Boiling Point | 444.6±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H6F6O6S2 | Melting Point | 115 °C |
|---|
| MSDS | / | Flash Point | 222.7±28.7 °C |
|---|
Names
| Name | [5-(trifluoromethylsulfonyloxy)naphthalen-1-yl] trifluoromethanesulfonate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.7±0.1 g/cm3 |
|---|
| Boiling Point | 444.6±45.0 °C at 760 mmHg |
|---|
| Melting Point | 115 °C |
|---|
| Molecular Formula | C12H6F6O6S2 |
|---|
| Molecular Weight | 424.293 |
|---|
| Flash Point | 222.7±28.7 °C |
|---|
| Exact Mass | 423.950989 |
|---|
| PSA | 103.50000 |
|---|
| LogP | 4.56 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.524 |
|---|
| InChIKey | IFHGSECJTKJJIJ-UHFFFAOYSA-N |
|---|
| SMILES | O=S(=O)(Oc1cccc2c(OS(=O)(=O)C(F)(F)F)cccc12)C(F)(F)F |
|---|
Synonyms
| 1,5-Naphthalenediyl bis(trifluoromethanesulfonate) |
| trifluoromethanesulfonic acid 5-trifluoromethanesulfonyloxynaphthalene-1-yl ester |
| Methanesulfonic acid, 1,1,1-trifluoro-, 1,5-naphthalenediyl ester |
| 1,5-bistrifluoromethanesulfononaphthalene |
| 1,5-bis(trifluoromethylsulfonyloxy)naphthalene |
| 1,5-Naphthalenebis(trifluoroMethanesulfonate) |
| 1,5-Naphthaleneditriflate |
| naphthalene-1,5-diyl bis(trifluoromethanesulfonate) |
| naphthalene-1,5-ditriflate |
| 1,5-Naphthyl bis(trifluoromethanesulfonate) |
| N0925 |