Introduction:Basic information about CAS 153265-90-8|[(1R,2S,3R,4R,5R,6S)-3-benzoyloxy-4-butanoyloxy-2,5,6-trihydroxycyclohexyl] benzoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | [(1R,2S,3R,4R,5R,6S)-3-benzoyloxy-4-butanoyloxy-2,5,6-trihydroxycyclohexyl] benzoate |
|---|
| CAS Number | 153265-90-8 | Molecular Weight | 458.45800 |
|---|
| Density | 1.311g/cm3 | Boiling Point | 756.3ºC at 760 mmHg |
|---|
| Molecular Formula | C24H26O9 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 411.2ºC |
|---|
Names
| Name | [(1R,2S,3R,4R,5R,6S)-3-benzoyloxy-4-butanoyloxy-2,5,6-trihydroxycyclohexyl] benzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.311g/cm3 |
|---|
| Boiling Point | 756.3ºC at 760 mmHg |
|---|
| Molecular Formula | C24H26O9 |
|---|
| Molecular Weight | 458.45800 |
|---|
| Flash Point | 411.2ºC |
|---|
| Exact Mass | 458.15800 |
|---|
| PSA | 139.59000 |
|---|
| LogP | 1.24580 |
|---|
| Vapour Pressure | 4.89E-24mmHg at 25°C |
|---|
| Index of Refraction | 1.702 |
|---|
| InChIKey | KTYAOQKEMRXFIY-NXOOKBFXSA-N |
|---|
| SMILES | CCCC(=O)OC1C(O)C(O)C(OC(=O)c2ccccc2)C(O)C1OC(=O)c1ccccc1 |
|---|
Safety Information
Synonyms
| Morphinan-6-one,17-(cyclopropylmethyl) |
| Morphinan-6-one,17-(cyclopropylmethyl)-(9CI) |
| MFCD03095518 |
| (-)-1D-1-O-butyryl-4,6-O-dibenzoyl-myo-inositol |
| 17-(Cyclopropylmethyl)morphinan-6-one |
| Cprmmo |