Introduction:Basic information about CAS 1533-77-3|2,2'-[[3-carbamoyl-4-[(2-methoxy-4-nitrophenyl)azo]phenyl]imino]diethyl diacetate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,2'-[[3-carbamoyl-4-[(2-methoxy-4-nitrophenyl)azo]phenyl]imino]diethyl diacetate |
|---|
| CAS Number | 1533-77-3 | Molecular Weight | 501.48900 |
|---|
| Density | 1.3g/cm3 | Boiling Point | 710.1ºC at 760 mmHg |
|---|
| Molecular Formula | C23H27N5O8 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 383.3ºC |
|---|
Names
| Name | 2-[3-acetamido-N-(2-acetyloxyethyl)-4-[(2-methoxy-4-nitrophenyl)diazenyl]anilino]ethyl acetate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3g/cm3 |
|---|
| Boiling Point | 710.1ºC at 760 mmHg |
|---|
| Molecular Formula | C23H27N5O8 |
|---|
| Molecular Weight | 501.48900 |
|---|
| Flash Point | 383.3ºC |
|---|
| Exact Mass | 501.18600 |
|---|
| PSA | 168.20000 |
|---|
| LogP | 5.08250 |
|---|
| Vapour Pressure | 5.16E-20mmHg at 25°C |
|---|
| Index of Refraction | 1.583 |
|---|
| InChIKey | ZQZWTTNVCIXDOF-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc([N+](=O)[O-])ccc1N=Nc1ccc(N(CCOC(C)=O)CCOC(C)=O)cc1NC(C)=O |
|---|
Synonyms
| ({3-(acetylamino)-4-[(e)-(2-methoxy-4-nitrophenyl)diazenyl]phenyl}imino)diethane-2,1-diyl diacetate |
| EINECS 216-250-0 |
| 2,2'-({3-carbamoyl-4-[(2-methoxy-4-nitrophenyl)azo]phenyl}imino)diethyl diacetate |