Introduction：Basic information about CAS 1582-05-4|2-Pentafluorophenyl-malonic acid diethyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Pentafluorophenyl-malonic acid diethyl ester |
|---|
| CAS Number | 1582-05-4 | Molecular Weight | 326.21600 |
|---|
| Density | 1.397g/cm3 | Boiling Point | 282.132ºC at 760 mmHg |
|---|
| Molecular Formula | C13H11F5O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 120.598ºC |
|---|
Names
| Name | diethyl 2-(2,3,4,5,6-pentafluorophenyl)propanedioate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.397g/cm3 |
|---|
| Boiling Point | 282.132ºC at 760 mmHg |
|---|
| Molecular Formula | C13H11F5O4 |
|---|
| Molecular Weight | 326.21600 |
|---|
| Flash Point | 120.598ºC |
|---|
| Exact Mass | 326.05800 |
|---|
| PSA | 52.60000 |
|---|
| LogP | 2.59190 |
|---|
| Vapour Pressure | 0.003mmHg at 25°C |
|---|
| Index of Refraction | 1.448 |
|---|
| InChIKey | ILXWVDXADPLRDY-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)C(C(=O)OCC)c1c(F)c(F)c(F)c(F)c1F |
|---|
Safety Information
Customs
| HS Code | 2917399090 |
|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| EC-000.1817 |
| Diethyl pentafluorophenyl-malonate |
| Pentafluorphenylmalonester |
| Pentafluorphenylmalonsaeurediethylester |
| Pentafluorphenylmalonsaeure-diaethylester |
| 2-Pentafluorophenyl-malonic acid diethyl ester |
| diethyl 2-(2,3,4,5,6-pentafluorophenyl)malonate |
| Diethyl 2-(perfluorophenyl)malonate |
