Introduction：Basic information about CAS 859961-96-9|N-(2-Naphthyl)sulfanilic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-(2-Naphthyl)sulfanilic acid |
|---|
| CAS Number | 859961-96-9 | Molecular Weight | 299.34400 |
|---|
| Density | 1.409 | Boiling Point | / |
|---|
| Molecular Formula | C16H13NO3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 4-(naphthalen-2-ylamino)benzenesulfonic acid |
|---|
Chemical & Physical Properties
| Density | 1.409 |
|---|
| Molecular Formula | C16H13NO3S |
|---|
| Molecular Weight | 299.34400 |
|---|
| Exact Mass | 299.06200 |
|---|
| PSA | 74.78000 |
|---|
| LogP | 4.98390 |
|---|
| Index of Refraction | 1.71 |
|---|
| InChIKey | NREPNHDVTUIDQF-UHFFFAOYSA-N |
|---|
| SMILES | O=S(=O)(O)c1ccc(Nc2ccc3ccccc3c2)cc1 |
|---|
Safety Information
Customs
| HS Code | 2921450090 |
|---|
| Summary | 2921450090 1-naphthylamine (α-naphthylamine), 2-naphthylamine (β-naphthylamine) and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
