Introduction：Basic information about CAS 6820-90-2|2-(2-Morpholin-4-yl-ethyl)-isoindole-1,3-dione, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(2-Morpholin-4-yl-ethyl)-isoindole-1,3-dione |
|---|
| CAS Number | 6820-90-2 | Molecular Weight | 260.288 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 412.1±30.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H16N2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 203.0±24.6 °C |
|---|
Names
| Name | 2-(2-morpholin-4-ylethyl)isoindole-1,3-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 412.1±30.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H16N2O3 |
|---|
| Molecular Weight | 260.288 |
|---|
| Flash Point | 203.0±24.6 °C |
|---|
| Exact Mass | 260.116089 |
|---|
| PSA | 49.85000 |
|---|
| LogP | 1.32 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.585 |
|---|
| InChIKey | HZYIEFBIKQXUHA-UHFFFAOYSA-N |
|---|
| SMILES | O=C1c2ccccc2C(=O)N1CCN1CCOCC1 |
|---|
Synonyms
| 2-Morpholino-1-phthalimido-aethan |
| 2-[2-(4-Morpholinyl)ethyl]-1H-isoindole-1,3(2H)-dione |
| 2-(2-Morpholin-4-yl-ethyl)-isoindole-1,3-dione |
| 1H-Isoindole-1,3(2H)-dione, 2-[2-(4-morpholinyl)ethyl]- |
