Introduction：Basic information about CAS 68214-66-4|2-ethoxyethyl [2-[(2-chloro-4-nitrophenyl)azo]-5-(diethylamino)phenyl]carbamate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-ethoxyethyl [2-[(2-chloro-4-nitrophenyl)azo]-5-(diethylamino)phenyl]carbamate |
|---|
| CAS Number | 68214-66-4 | Molecular Weight | 463.91500 |
|---|
| Density | 1.28g/cm3 | Boiling Point | 585.4ºC at 760 mmHg |
|---|
| Molecular Formula | C21H26ClN5O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 307.9ºC |
|---|
Names
| Name | 2-ethoxyethyl N-[2-[(2-chloro-4-nitrophenyl)diazenyl]-5-(diethylamino)phenyl]carbamate |
|---|
Chemical & Physical Properties
| Density | 1.28g/cm3 |
|---|
| Boiling Point | 585.4ºC at 760 mmHg |
|---|
| Molecular Formula | C21H26ClN5O5 |
|---|
| Molecular Weight | 463.91500 |
|---|
| Flash Point | 307.9ºC |
|---|
| Exact Mass | 463.16200 |
|---|
| PSA | 124.83000 |
|---|
| LogP | 6.63160 |
|---|
| Index of Refraction | 1.584 |
|---|
| InChIKey | BASKGNLLUQTLND-UHFFFAOYSA-N |
|---|
| SMILES | CCOCCOC(=O)Nc1cc(N(CC)CC)ccc1N=Nc1ccc([N+](=O)[O-])cc1Cl |
|---|
