Introduction：Basic information about CAS 85392-14-9|2,2'-methylenebis[6-(o-isocyanatobenzyl)phenyl] diisocyanate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,2'-methylenebis[6-(o-isocyanatobenzyl)phenyl] diisocyanate |
|---|
| CAS Number | 85392-14-9 | Molecular Weight | 512.51500 |
|---|
| Density | 1.2g/cm3 | Boiling Point | 671.6ºC at 760 mmHg |
|---|
| Molecular Formula | C31H20N4O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 268.5ºC |
|---|
Names
| Name | 2-isocyanato-1-[[2-isocyanato-3-[(2-isocyanatophenyl)methyl]phenyl]methyl]-3-[(2-isocyanatophenyl)methyl]benzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2g/cm3 |
|---|
| Boiling Point | 671.6ºC at 760 mmHg |
|---|
| Molecular Formula | C31H20N4O4 |
|---|
| Molecular Weight | 512.51500 |
|---|
| Flash Point | 268.5ºC |
|---|
| Exact Mass | 512.14800 |
|---|
| PSA | 117.72000 |
|---|
| LogP | 6.32820 |
|---|
| Index of Refraction | 1.628 |
|---|
| InChIKey | BYABUGFHWIOBQQ-UHFFFAOYSA-N |
|---|
| SMILES | O=C=Nc1ccccc1Cc1cccc(Cc2cccc(Cc3ccccc3N=C=O)c2N=C=O)c1N=C=O |
|---|
Synonyms
| 1,1'-methanediylbis[2-isocyanato-3-(2-isocyanatobenzyl)benzene] |
| EINECS 286-872-5 |
| 2,2'-Methylenebis(6-(o-isocyanatobenzyl)phenyl) diisocyanate |
| Benzene,1,1'-methylenebis(2-isocyanato-3-((2-isocyanatophenyl)methyl) |
