Introduction：Basic information about CAS 85418-85-5|(Z)-1-[4-[1-hydroxy-1-(4-propan-2-ylsulfanylphenyl)propan-2-yl]piperazin-1-yl]-3-phen, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (Z)-1-[4-[1-hydroxy-1-(4-propan-2-ylsulfanylphenyl)propan-2-yl]piperazin-1-yl]-3-phenylprop-2-en-1-one |
|---|
| CAS Number | 85418-85-5 | Molecular Weight | 424.59900 |
|---|
| Density | 1.18g/cm3 | Boiling Point | 625.1ºC at 760 mmHg |
|---|
| Molecular Formula | C25H32N2O2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 331.9ºC |
|---|
Names
| Name | (Z)-1-[4-[1-hydroxy-1-(4-propan-2-ylsulfanylphenyl)propan-2-yl]piperazin-1-yl]-3-phenylprop-2-en-1-one |
|---|
Chemical & Physical Properties
| Density | 1.18g/cm3 |
|---|
| Boiling Point | 625.1ºC at 760 mmHg |
|---|
| Molecular Formula | C25H32N2O2S |
|---|
| Molecular Weight | 424.59900 |
|---|
| Flash Point | 331.9ºC |
|---|
| Exact Mass | 424.21800 |
|---|
| PSA | 69.08000 |
|---|
| LogP | 4.34240 |
|---|
| Index of Refraction | 1.625 |
|---|
| InChIKey | UUHFEOMKFKXLCB-CJFMBICVSA-N |
|---|
| SMILES | CC(C)Sc1ccc(C(O)C(C)N2CCN(C(=O)C=Cc3ccccc3)CC2)cc1 |
|---|
