Introduction：Basic information about CAS 90395-45-2|4-(PYRIDIN-3-YL)BENZALDEHYDE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(PYRIDIN-3-YL)BENZALDEHYDE |
|---|
| CAS Number | 90395-45-2 | Molecular Weight | 197.23300 |
|---|
| Density | 1.098g/cm3 | Boiling Point | 346.7ºC at 760 mmHg |
|---|
| Molecular Formula | C13H11NO | Melting Point | / |
|---|
| MSDS | / | Flash Point | 171.4ºC |
|---|
Names
| Name | 1-(4-pyridin-3-ylphenyl)ethanone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.098g/cm3 |
|---|
| Boiling Point | 346.7ºC at 760 mmHg |
|---|
| Molecular Formula | C13H11NO |
|---|
| Molecular Weight | 197.23300 |
|---|
| Flash Point | 171.4ºC |
|---|
| Exact Mass | 197.08400 |
|---|
| PSA | 29.96000 |
|---|
| LogP | 2.95120 |
|---|
| Index of Refraction | 1.57 |
|---|
| InChIKey | YDAFIGBEEBFUKV-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)c1ccc(-c2cccnc2)cc1 |
|---|
Synonyms
| 4-(pyridin-3-yl)phenyl methyl ketone |
| 4-(3-pyridinyl)acetophenone |
| Ethanone,1-[4-(3-pyridinyl)phenyl] |
| 1-[4-(3-pyridinyl)phenyl]ethanone |
| 1-(4-pyridine-3-ylphenyl)ethanone |
| 1-[4-(pyridin-3-yl)phenyl]ethanone |
