Introduction：Basic information about CAS 26022-09-3|azane,furan-2,5-dione,styrene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | azane,furan-2,5-dione,styrene |
|---|
| CAS Number | 26022-09-3 | Molecular Weight | 219.23700 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C12H13NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | azane,furan-2,5-dione,styrene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C12H13NO3 |
|---|
| Molecular Weight | 219.23700 |
|---|
| Exact Mass | 219.09000 |
|---|
| PSA | 46.61000 |
|---|
| LogP | 2.27950 |
|---|
| InChIKey | KCBSKDJPNLVSLE-UHFFFAOYSA-N |
|---|
| SMILES | C=Cc1ccccc1.N.O=C1C=CC(=O)O1 |
|---|
Synonyms
| 2,5-Furandione,styrene polymer,ammonium salt |
| 2,5-Furandione,polymer with ethenylbenzene,ammonium salt |
| furan-2,5-dione-ethenylbenzene ammoniate(1:1:1) |
| Styrene,maleic anhydride polymer,ammonium salt |
| Styrene,maleic anhydride resin ammonium salt |
