Introduction：Basic information about CAS 20566-35-2|3,4,5,6-Tetrabromo-1,2-benzenedicarboxylic acid2-(2-hydroxyethoxy)-ethyl2-hydroxyprop, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3,4,5,6-Tetrabromo-1,2-benzenedicarboxylic acid2-(2-hydroxyethoxy)-ethyl2-hydroxypropylester |
|---|
| CAS Number | 20566-35-2 | Molecular Weight | 627.89900 |
|---|
| Density | 1.998g/cm3 | Boiling Point | 598.5ºC at 760mmHg |
|---|
| Molecular Formula | C15H16Br4O7 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 315.8ºC |
|---|
Names
| Name | 1-O-[2-(2-hydroxyethoxy)ethyl] 2-O-(2-hydroxypropyl) 3,4,5,6-tetrabromobenzene-1,2-dicarboxylate |
|---|
Chemical & Physical Properties
| Density | 1.998g/cm3 |
|---|
| Boiling Point | 598.5ºC at 760mmHg |
|---|
| Molecular Formula | C15H16Br4O7 |
|---|
| Molecular Weight | 627.89900 |
|---|
| Flash Point | 315.8ºC |
|---|
| Exact Mass | 623.76300 |
|---|
| PSA | 102.29000 |
|---|
| LogP | 3.43990 |
|---|
| Index of Refraction | 1.61 |
|---|
| InChIKey | OQHHASWHOGRCRC-UHFFFAOYSA-N |
|---|
| SMILES | CC(O)COC(=O)c1c(Br)c(Br)c(Br)c(Br)c1C(=O)OCCOCCO |
|---|
