Introduction：Basic information about CAS 154461-65-1|sinapaldehyde glucoside, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | sinapaldehyde glucoside |
|---|
| CAS Number | 154461-65-1 | Molecular Weight | 370.351 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 633.5±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C17H22O9 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 229.2±25.0 °C |
|---|
Names
| Name | Sinapaldehyde glucoside |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 633.5±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C17H22O9 |
|---|
| Molecular Weight | 370.351 |
|---|
| Flash Point | 229.2±25.0 °C |
|---|
| Exact Mass | 370.126373 |
|---|
| PSA | 134.91000 |
|---|
| LogP | -1.51 |
|---|
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.612 |
|---|
| InChIKey | OYTCTPHTVUEGCL-JSMXJDTGSA-N |
|---|
| SMILES | COc1cc(C=CC=O)cc(OC)c1OC1OC(CO)C(O)C(O)C1O |
|---|
Safety Information
Synonyms
| 2-Propenal, 3-[4-(D-glucopyranosyloxy)-3,5-dimethoxyphenyl]-, (2E)- |
| Sinapyl 4-O-β-D-glucopyranoside aldehyde |
| sinapaldehyde glucoside |
| 2,6-Dimethoxy-4-[(1E)-3-oxo-1-propen-1-yl]phenyl D-glucopyranoside |
| 2,6-dimethoxy-4-[(1E)-3-oxoprop-1-en-1-yl]phenyl β-D-glucopyranoside |
| 2,6-Dimethoxy-4-[(1E)-3-oxo-1-propen-1-yl]phenyl β-D-glucopyranoside |
| 2-Propenal, 3-[4-(β-D-glucopyranosyloxy)-3,5-dimethoxyphenyl]-, (2E)- |
