Introduction：Basic information about CAS 518357-40-9|[4-(4-Fluorophenyl)phenyl]methylamine hydrochloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | [4-(4-Fluorophenyl)phenyl]methylamine hydrochloride |
|---|
| CAS Number | 518357-40-9 | Molecular Weight | 237.70000 |
|---|
| Density | 1.124g/cm3 | Boiling Point | 322.9ºC at 760 mmHg |
|---|
| Molecular Formula | C13H13ClFN | Melting Point | / |
|---|
| MSDS | / | Flash Point | 159.9ºC |
|---|
Names
| Name | c-(4'-fluoro-biphenyl-4-yl)-methylamine hydrochloride |
|---|
Chemical & Physical Properties
| Density | 1.124g/cm3 |
|---|
| Boiling Point | 322.9ºC at 760 mmHg |
|---|
| Molecular Formula | C13H13ClFN |
|---|
| Molecular Weight | 237.70000 |
|---|
| Flash Point | 159.9ºC |
|---|
| Exact Mass | 237.07200 |
|---|
| PSA | 26.02000 |
|---|
| LogP | 4.45370 |
|---|
| Index of Refraction | 1.576 |
|---|
| InChIKey | IZUWYHXAARRMGW-UHFFFAOYSA-N |
|---|
| SMILES | Cl.NCc1ccc(-c2ccc(F)cc2)cc1 |
|---|
