Introduction:Basic information about CAS 207974-14-9|4-Bromo-2,5-difluorobenzenesulfonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Bromo-2,5-difluorobenzenesulfonyl chloride |
|---|
| CAS Number | 207974-14-9 | Molecular Weight | 291.498 |
|---|
| Density | 1.9±0.1 g/cm3 | Boiling Point | 263.5±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C6H2BrClF2O2S | Melting Point | 38-42 °C(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 113.1±25.9 °C |
|---|
| Symbol | GHS05 | Signal Word | Danger |
|---|
Names
| Name | 4-bromo-2,5-difluorobenzenesulfonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.9±0.1 g/cm3 |
|---|
| Boiling Point | 263.5±35.0 °C at 760 mmHg |
|---|
| Melting Point | 38-42 °C(lit.) |
|---|
| Molecular Formula | C6H2BrClF2O2S |
|---|
| Molecular Weight | 291.498 |
|---|
| Flash Point | 113.1±25.9 °C |
|---|
| Exact Mass | 289.861542 |
|---|
| PSA | 42.52000 |
|---|
| LogP | 3.22 |
|---|
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.555 |
|---|
| InChIKey | SBMKFWMFNIEPDN-UHFFFAOYSA-N |
|---|
| SMILES | O=S(=O)(Cl)c1cc(F)c(Br)cc1F |
|---|
Safety Information
| Symbol | GHS05 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H314 |
|---|
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
|---|
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
|---|
| Hazard Codes | C:Corrosive; |
|---|
| Risk Phrases | R34 |
|---|
| Safety Phrases | S26-S36/37/39-S45 |
|---|
| RIDADR | UN 3261 8/PG 3 |
|---|
| WGK Germany | 3 |
|---|
| Packaging Group | II |
|---|
| Hazard Class | 8 |
|---|
| HS Code | 2904909090 |
|---|
Customs
| HS Code | 2904909090 |
|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 4-bromo-2,5-difluorobenzene-1-sulfonyl chloride |
| 4-bromo-2,5-difluorobenzenesulphonyl chloride |
| 4-Bromo-2,5-difluorobenzene-1-sulfonylchloride |
| Benzenesulfonyl chloride, 4-bromo-2,5-difluoro- |
| WSGR BF EF DE |
| MFCD00042181 |
| 4-Bromo-2,5-difluorobenzenesulfonyl chloride |
| 4-bromo-3,6-difluoro-benzenesulfonylchloride |